C40H27N4S+ — CID 123548729
20-(4,6-diphenylpyrimidin-2-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene (PubChem CID 123548729) has the molecular formula C40H27N4S+ and a molecular weight of 595.75 g/mol. Its IUPAC name is 20-(4,6-diphenylpyrimidin-2-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene.
| Compound Name | 20-(4,6-diphenylpyrimidin-2-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
|---|---|
| PubChem CID | 123548729 |
| Molecular Formula | C40H27N4S+ |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 20-(4,6-diphenylpyrimidin-2-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
| SMILES | C1=CC2=C3CC4=C(C=C3SC2C=C1)C1=CC=CC2=[N+](c3nc(-c5ccccc5)cc(-c5ccccc5)n3)c3ccccc3N4C12 |
| InChI | InChI=1S/C40H27N4S/c1-3-12-25(13-4-1)31-24-32(26-14-5-2-6-15-26)42-40(41-31)44-34-19-9-8-18-33(34)43-36-22-30-27-16-7-10-21-37(27)45-38(30)23-29(36)28-17-11-20-35(44)39(28)43/h1-21,23-24,37,39H,22H2/q+1 |
| InChIKey | UINQOUVEXFUWBB-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 32.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|