C42H29N2S+ — CID 123437961
20-(3,5-diphenylphenyl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene (PubChem CID 123437961) has the molecular formula C42H29N2S+ and a molecular weight of 593.78 g/mol. Its IUPAC name is 20-(3,5-diphenylphenyl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene.
| Compound Name | 20-(3,5-diphenylphenyl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
|---|---|
| PubChem CID | 123437961 |
| Molecular Formula | C42H29N2S+ |
| Molecular Weight | 593.78 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 20-(3,5-diphenylphenyl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
| SMILES | C1=CC2=C3CC4=C(C=C3SC2C=C1)C1=CC=CC2=[N+](c3cc(-c5ccccc5)cc(-c5ccccc5)c3)c3ccccc3N4C12 |
| InChI | InChI=1S/C42H29N2S/c1-3-12-27(13-4-1)29-22-30(28-14-5-2-6-15-28)24-31(23-29)43-36-18-8-9-19-37(36)44-39-25-35-32-16-7-10-21-40(32)45-41(35)26-34(39)33-17-11-20-38(43)42(33)44/h1-24,26,40,42H,25H2/q+1 |
| InChIKey | WTLBTXRIBHLSNP-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.78 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|