C17H12F3NO — CID 123253866
5-[4-(2,2,2-trifluoroethyl)phenyl]-1H-indole-3-carbaldehyde (PubChem CID 123253866) has the molecular formula C17H12F3NO and a molecular weight of 303.28 g/mol. Its IUPAC name is 5-[4-(2,2,2-trifluoroethyl)phenyl]-1H-indole-3-carbaldehyde.
| Compound Name | 5-[4-(2,2,2-trifluoroethyl)phenyl]-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 123253866 |
| Molecular Formula | C17H12F3NO |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-[4-(2,2,2-trifluoroethyl)phenyl]-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c[nH]c2ccc(-c3ccc(CC(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C17H12F3NO/c18-17(19,20)8-11-1-3-12(4-2-11)13-5-6-16-15(7-13)14(10-22)9-21-16/h1-7,9-10,21H,8H2 |
| InChIKey | KLBJISWMTRDDIE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|