C27H26N2O — CID 174611315
5-(4-imino-2-methyl-1,5-diphenylpentan-2-yl)-1H-indole-3-carbaldehyde (PubChem CID 174611315) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is 5-(4-imino-2-methyl-1,5-diphenylpentan-2-yl)-1H-indole-3-carbaldehyde.
| Compound Name | 5-(4-imino-2-methyl-1,5-diphenylpentan-2-yl)-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 174611315 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 5-(4-imino-2-methyl-1,5-diphenylpentan-2-yl)-1H-indole-3-carbaldehyde |
| SMILES | [H]/N=C(\Cc1ccccc1)CC(C)(Cc1ccccc1)c1ccc2[nH]cc(C=O)c2c1 |
| InChI | InChI=1S/C27H26N2O/c1-27(16-21-10-6-3-7-11-21,17-24(28)14-20-8-4-2-5-9-20)23-12-13-26-25(15-23)22(19-30)18-29-26/h2-13,15,18-19,28-29H,14,16-17H2,1H3/b28-24+ |
| InChIKey | FOKLVRLPDFYGJL-ZZIIXHQDSA-N |
| XLogP | 6.13 |
| TPSA | 56.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|