C11H8F3NO — CID 96602958
5-(2,2,2-trifluoroethyl)-1H-indole-3-carbaldehyde (PubChem CID 96602958) has the molecular formula C11H8F3NO and a molecular weight of 227.19 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethyl)-1H-indole-3-carbaldehyde.
| Compound Name | 5-(2,2,2-trifluoroethyl)-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 96602958 |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 5-(2,2,2-trifluoroethyl)-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c[nH]c2ccc(CC(F)(F)F)cc12 |
| InChI | InChI=1S/C11H8F3NO/c12-11(13,14)4-7-1-2-10-9(3-7)8(6-16)5-15-10/h1-3,5-6,15H,4H2 |
| InChIKey | PBBDIVLQKFEOLL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|