C26H29Cl2N3O — CID 123254020
1-[6-(4-amino-3,5-dichlorophenyl)-4-[(4-methylcyclohexyl)amino]quinolin-3-yl]-2-methylpropan-1-one (PubChem CID 123254020) has the molecular formula C26H29Cl2N3O and a molecular weight of 470.44 g/mol. Its IUPAC name is 1-[6-(4-amino-3,5-dichlorophenyl)-4-[(4-methylcyclohexyl)amino]quinolin-3-yl]-2-methylpropan-1-one.
| Compound Name | 1-[6-(4-amino-3,5-dichlorophenyl)-4-[(4-methylcyclohexyl)amino]quinolin-3-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 123254020 |
| Molecular Formula | C26H29Cl2N3O |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 1-[6-(4-amino-3,5-dichlorophenyl)-4-[(4-methylcyclohexyl)amino]quinolin-3-yl]-2-methylpropan-1-one |
| SMILES | CC1CCC(Nc2c(C(=O)C(C)C)cnc3ccc(-c4cc(Cl)c(N)c(Cl)c4)cc23)CC1 |
| InChI | InChI=1S/C26H29Cl2N3O/c1-14(2)26(32)20-13-30-23-9-6-16(17-11-21(27)24(29)22(28)12-17)10-19(23)25(20)31-18-7-4-15(3)5-8-18/h6,9-15,18H,4-5,7-8,29H2,1-3H3,(H,30,31) |
| InChIKey | KDCAHTKXJKLXAX-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|