C8H13NS — CID 123254253
2-(cyclobutylmethyl)-4,5-dihydro-1,3-thiazole (PubChem CID 123254253) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(cyclobutylmethyl)-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 123254253 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-(cyclobutylmethyl)-4,5-dihydro-1,3-thiazole |
| SMILES | C1CC(CC2=NCCS2)C1 |
| InChI | InChI=1S/C8H13NS/c1-2-7(3-1)6-8-9-4-5-10-8/h7H,1-6H2 |
| InChIKey | UFLVXIHFARBTAC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |