C10H11NOS — CID 170458380
2-(4,5-dihydro-1,3-thiazol-2-ylmethyl)phenol (PubChem CID 170458380) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylmethyl)phenol.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 170458380 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylmethyl)phenol |
| SMILES | Oc1ccccc1CC1=NCCS1 |
| InChI | InChI=1S/C10H11NOS/c12-9-4-2-1-3-8(9)7-10-11-5-6-13-10/h1-4,12H,5-7H2 |
| InChIKey | XTHPJZZUZWCDOY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |