About 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol
2-(cyclopenta-1,3-dien-1-ylmethyl)phenol (PubChem CID 70505882) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol.
Molecular Properties
| Compound Name | 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol |
| PubChem CID | 70505882 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol |
| SMILES | Oc1ccccc1CC1=CC=CC1 |
| InChI | InChI=1S/C12H12O/c13-12-8-4-3-7-11(12)9-10-5-1-2-6-10/h1-5,7-8,13H,6,9H2 |
| InChIKey | VGPBENWRNBCHOX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol?
The IUPAC name of 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol (CID 70505882) is 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol.
What is the SMILES notation for 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol?
The canonical SMILES for 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol is Oc1ccccc1CC1=CC=CC1.
What is the InChIKey of 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol?
The InChIKey is VGPBENWRNBCHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c13-12-8-4-3-7-11(12)9-10-5-1-2-6-10/h1-5,7-8,13H,6,9H2.
What are the key properties of 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol?
2-(cyclopenta-1,3-dien-1-ylmethyl)phenol has a molecular weight of 172.23 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopenta-1,3-dien-1-ylmethyl)phenol is sourced from PubChem (CID 70505882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).