C5H6NNaO2S — CID 23679119
sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)acetate (PubChem CID 23679119) has the molecular formula C5H6NNaO2S and a molecular weight of 167.16 g/mol. Its IUPAC name is sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)acetate.
| Compound Name | sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)acetate |
|---|---|
| PubChem CID | 23679119 |
| Molecular Formula | C5H6NNaO2S |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)acetate |
| SMILES | O=C([O-])CC1=NCCS1.[Na+] |
| InChI | InChI=1S/C5H7NO2S.Na/c7-5(8)3-4-6-1-2-9-4;/h1-3H2,(H,7,8);/q;+1/p-1 |
| InChIKey | APBBOBYWSBUIDV-UHFFFAOYSA-M |
| XLogP | -3.72 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |