C11H11N3O3S — CID 4302593
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide (PubChem CID 4302593) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4302593 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NC1=NCCS1 |
| InChI | InChI=1S/C11H11N3O3S/c15-10(13-11-12-5-6-18-11)7-8-1-3-9(4-2-8)14(16)17/h1-4H,5-7H2,(H,12,13,15) |
| InChIKey | RPAPLXVOPYUBPI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|