C10H12N2Na2O4 — CID 135121958
disodium;3-[6-(2-carboxylatoethyl)-2,5-dihydropyrazin-3-yl]propanoate (PubChem CID 135121958) has the molecular formula C10H12N2Na2O4 and a molecular weight of 270.20 g/mol. Its IUPAC name is disodium;3-[6-(2-carboxylatoethyl)-2,5-dihydropyrazin-3-yl]propanoate.
| Compound Name | disodium;3-[6-(2-carboxylatoethyl)-2,5-dihydropyrazin-3-yl]propanoate |
|---|---|
| PubChem CID | 135121958 |
| Molecular Formula | C10H12N2Na2O4 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | disodium;3-[6-(2-carboxylatoethyl)-2,5-dihydropyrazin-3-yl]propanoate |
| SMILES | O=C([O-])CCC1=NCC(CCC(=O)[O-])=NC1.[Na+].[Na+] |
| InChI | InChI=1S/C10H14N2O4.2Na/c13-9(14)3-1-7-5-12-8(6-11-7)2-4-10(15)16;;/h1-6H2,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | OQIUMHKFMGOWHR-UHFFFAOYSA-L |
| XLogP | -8.05 |
| TPSA | 104.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | -8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |