C10H18N2S — CID 154476340
2-(cyclohexylmethyl)-4,5-dihydro-1,3-thiazol-4-amine (PubChem CID 154476340) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4,5-dihydro-1,3-thiazol-4-amine.
| Compound Name | 2-(cyclohexylmethyl)-4,5-dihydro-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 154476340 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-(cyclohexylmethyl)-4,5-dihydro-1,3-thiazol-4-amine |
| SMILES | NC1CSC(CC2CCCCC2)=N1 |
| InChI | InChI=1S/C10H18N2S/c11-9-7-13-10(12-9)6-8-4-2-1-3-5-8/h8-9H,1-7,11H2 |
| InChIKey | WMDUTSZWNBDADQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |