C14H24 — CID 123255014
1-methyl-5-(2-methylcyclobutyl)-2-propan-2-ylspiro[2.2]pentane (PubChem CID 123255014) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1-methyl-5-(2-methylcyclobutyl)-2-propan-2-ylspiro[2.2]pentane.
| Compound Name | 1-methyl-5-(2-methylcyclobutyl)-2-propan-2-ylspiro[2.2]pentane |
|---|---|
| PubChem CID | 123255014 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1-methyl-5-(2-methylcyclobutyl)-2-propan-2-ylspiro[2.2]pentane |
| SMILES | CC(C)C1C(C)C12CC2C1CCC1C |
| InChI | InChI=1S/C14H24/c1-8(2)13-10(4)14(13)7-12(14)11-6-5-9(11)3/h8-13H,5-7H2,1-4H3 |
| InChIKey | QFFITVSLUBJKPE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |