C17H24N4 — CID 123256142
6-(cyclohexen-1-yl)-3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-2,5-dihydro-1H-1,2,4,5-tetrazepine (PubChem CID 123256142) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)-3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-2,5-dihydro-1H-1,2,4,5-tetrazepine.
| Compound Name | 6-(cyclohexen-1-yl)-3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-2,5-dihydro-1H-1,2,4,5-tetrazepine |
|---|---|
| PubChem CID | 123256142 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 6-(cyclohexen-1-yl)-3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-2,5-dihydro-1H-1,2,4,5-tetrazepine |
| SMILES | CC=C/C=C(\C=C/C)c1n[nH]c(C2=CCCCC2)c[nH][nH]1 |
| InChI | InChI=1S/C17H24N4/c1-3-5-10-15(9-4-2)17-20-18-13-16(19-21-17)14-11-7-6-8-12-14/h3-5,9-11,13,18-19H,6-8,12H2,1-2H3,(H,20,21)/b5-3?,9-4-,15-10+ |
| InChIKey | XSFILIUKBZNOAD-PHLWFODBSA-N |
| XLogP | 4.68 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|