C10H12N4 — CID 138748277
3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,2,4,5-tetrazine (PubChem CID 138748277) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,2,4,5-tetrazine.
| Compound Name | 3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 138748277 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,2,4,5-tetrazine |
| SMILES | C/C=C\C=C(/C=C\C)c1nncnn1 |
| InChI | InChI=1S/C10H12N4/c1-3-5-7-9(6-4-2)10-13-11-8-12-14-10/h3-8H,1-2H3/b5-3-,6-4-,9-7+ |
| InChIKey | SCPIGEASQVOMPY-AQJMMWSSSA-N |
| XLogP | 1.80 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|