C18H22N2 — CID 144586960
5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-pyrazole (PubChem CID 144586960) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-pyrazole.
| Compound Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 144586960 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-pyrazole |
| SMILES | C=C/C=C\C(=C/C)c1[nH]ncc1C(/C=C\C)=C/C=C\C |
| InChI | InChI=1S/C18H22N2/c1-5-9-12-15(8-4)18-17(14-19-20-18)16(11-7-3)13-10-6-2/h5-14H,1H2,2-4H3,(H,19,20)/b10-6-,11-7-,12-9-,15-8+,16-13+ |
| InChIKey | FBKCMQZGWIYJFQ-GHBBFUHJSA-N |
| XLogP | 5.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|