C16H19NO2 — CID 139382706
4-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-[(1E,3Z)-1-methoxyhexa-1,3,5-trien-2-yl]-1,2-oxazole (PubChem CID 139382706) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-[(1E,3Z)-1-methoxyhexa-1,3,5-trien-2-yl]-1,2-oxazole.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-[(1E,3Z)-1-methoxyhexa-1,3,5-trien-2-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 139382706 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-[(1E,3Z)-1-methoxyhexa-1,3,5-trien-2-yl]-1,2-oxazole |
| SMILES | C=C/C=C\C(=C/OC)c1nocc1C(/C=C\C)=C/C |
| InChI | InChI=1S/C16H19NO2/c1-5-8-10-14(11-18-4)16-15(12-19-17-16)13(7-3)9-6-2/h5-12H,1H2,2-4H3/b9-6-,10-8-,13-7+,14-11+ |
| InChIKey | MZELVOATYUKFEE-KIUVKEFYSA-N |
| XLogP | 4.38 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|