C15H16F3NO2S — CID 162592978
ethyl 2-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (PubChem CID 162592978) has the molecular formula C15H16F3NO2S and a molecular weight of 331.36 g/mol. Its IUPAC name is ethyl 2-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 162592978 |
| Molecular Formula | C15H16F3NO2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | ethyl 2-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| SMILES | C/C=C\C(=C/C=C/C)c1nc(C(F)(F)F)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C15H16F3NO2S/c1-4-7-9-10(8-5-2)13-19-12(15(16,17)18)11(22-13)14(20)21-6-3/h4-5,7-9H,6H2,1-3H3/b7-4+,8-5-,10-9+ |
| InChIKey | SNUQWBRUFXKBHA-GTHKGYQJSA-N |
| XLogP | 4.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|