C37H56N8O6 — CID 123256751
3,5-diamino-N-[2-[[[4-[2-[hexyl(2,3,4,5-tetrahydroxypentyl)amino]ethylcarbamoyl]phenyl]methylamino]methyl]-3-(2-methylphenyl)propyl]pyrazine-2-carboxamide (PubChem CID 123256751) has the molecular formula C37H56N8O6 and a molecular weight of 708.91 g/mol. Its IUPAC name is 3,5-diamino-N-[2-[[[4-[2-[hexyl(2,3,4,5-tetrahydroxypentyl)amino]ethylcarbamoyl]phenyl]methylamino]methyl]-3-(2-methylphenyl)propyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[2-[[[4-[2-[hexyl(2,3,4,5-tetrahydroxypentyl)amino]ethylcarbamoyl]phenyl]methylamino]methyl]-3-(2-methylphenyl)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123256751 |
| Molecular Formula | C37H56N8O6 |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 708.43 |
| IUPAC Name | 3,5-diamino-N-[2-[[[4-[2-[hexyl(2,3,4,5-tetrahydroxypentyl)amino]ethylcarbamoyl]phenyl]methylamino]methyl]-3-(2-methylphenyl)propyl]pyrazine-2-carboxamide |
| SMILES | CCCCCCN(CCNC(=O)c1ccc(CNCC(CNC(=O)c2ncc(N)nc2N)Cc2ccccc2C)cc1)CC(O)C(O)C(O)CO |
| InChI | InChI=1S/C37H56N8O6/c1-3-4-5-8-16-45(23-30(47)34(49)31(48)24-46)17-15-41-36(50)28-13-11-26(12-14-28)19-40-20-27(18-29-10-7-6-9-25(29)2)21-43-37(51)33-35(39)44-32(38)22-42-33/h6-7,9-14,22,27,30-31,34,40,46-49H,3-5,8,15-21,23-24H2,1-2H3,(H,41,50)(H,43,51)(H4,38,39,44) |
| InChIKey | XNWUXNRWIVHFBL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 232.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|