About N'-ethyl-N'-pentyl-N-propylmethanediamine
N'-ethyl-N'-pentyl-N-propylmethanediamine (PubChem CID 123257477) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is N'-ethyl-N'-pentyl-N-propylmethanediamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-pentyl-N-propylmethanediamine |
| PubChem CID | 123257477 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | N'-ethyl-N'-pentyl-N-propylmethanediamine |
| SMILES | CCCCCN(CC)CNCCC |
| InChI | InChI=1S/C11H26N2/c1-4-7-8-10-13(6-3)11-12-9-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | DEMOWOLFPUMQJA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-pentyl-N-propylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-pentyl-N-propylmethanediamine?
The IUPAC name of N'-ethyl-N'-pentyl-N-propylmethanediamine (CID 123257477) is N'-ethyl-N'-pentyl-N-propylmethanediamine.
What is the SMILES notation for N'-ethyl-N'-pentyl-N-propylmethanediamine?
The canonical SMILES for N'-ethyl-N'-pentyl-N-propylmethanediamine is CCCCCN(CC)CNCCC.
What is the InChIKey of N'-ethyl-N'-pentyl-N-propylmethanediamine?
The InChIKey is DEMOWOLFPUMQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2/c1-4-7-8-10-13(6-3)11-12-9-5-2/h12H,4-11H2,1-3H3.
What are the key properties of N'-ethyl-N'-pentyl-N-propylmethanediamine?
N'-ethyl-N'-pentyl-N-propylmethanediamine has a molecular weight of 186.34 g/mol, XLogP of 2.46, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-pentyl-N-propylmethanediamine is sourced from PubChem (CID 123257477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).