C26H34N2O — CID 123259293
3-(4,4,10,13-tetramethyl-3-nitroso-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl)pyridine (PubChem CID 123259293) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is 3-(4,4,10,13-tetramethyl-3-nitroso-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl)pyridine.
| Compound Name | 3-(4,4,10,13-tetramethyl-3-nitroso-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl)pyridine |
|---|---|
| PubChem CID | 123259293 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 3-(4,4,10,13-tetramethyl-3-nitroso-1,2,3,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl)pyridine |
| SMILES | CC1(C)C2=CCC3C4CC=C(c5cccnc5)C4(C)CCC3C2(C)CCC1N=O |
| InChI | InChI=1S/C26H34N2O/c1-24(2)22-10-7-18-20-9-8-19(17-6-5-15-27-16-17)25(20,3)13-11-21(18)26(22,4)14-12-23(24)28-29/h5-6,8,10,15-16,18,20-21,23H,7,9,11-14H2,1-4H3 |
| InChIKey | GCRYIBIGNPSYHS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|