C27H37N9O3 — CID 123261029
2,6-diamino-N-[7-[2-[4-(2-cyanoethylamino)-1,2,5-oxadiazol-3-yl]benzimidazol-1-yl]-5-ethyl-6-hydroxyhepta-1,3-dien-2-yl]hexanamide (PubChem CID 123261029) has the molecular formula C27H37N9O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2,6-diamino-N-[7-[2-[4-(2-cyanoethylamino)-1,2,5-oxadiazol-3-yl]benzimidazol-1-yl]-5-ethyl-6-hydroxyhepta-1,3-dien-2-yl]hexanamide.
| Compound Name | 2,6-diamino-N-[7-[2-[4-(2-cyanoethylamino)-1,2,5-oxadiazol-3-yl]benzimidazol-1-yl]-5-ethyl-6-hydroxyhepta-1,3-dien-2-yl]hexanamide |
|---|---|
| PubChem CID | 123261029 |
| Molecular Formula | C27H37N9O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | 2,6-diamino-N-[7-[2-[4-(2-cyanoethylamino)-1,2,5-oxadiazol-3-yl]benzimidazol-1-yl]-5-ethyl-6-hydroxyhepta-1,3-dien-2-yl]hexanamide |
| SMILES | C=C(C=CC(CC)C(O)Cn1c(-c2nonc2NCCC#N)nc2ccccc21)NC(=O)C(N)CCCCN |
| InChI | InChI=1S/C27H37N9O3/c1-3-19(13-12-18(2)32-27(38)20(30)9-6-7-14-28)23(37)17-36-22-11-5-4-10-21(22)33-26(36)24-25(35-39-34-24)31-16-8-15-29/h4-5,10-13,19-20,23,37H,2-3,6-9,14,16-17,28,30H2,1H3,(H,31,35)(H,32,38) |
| InChIKey | UMAQUNGRXMSZSP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 193.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|