C20H17F2N7O — CID 161322135
3-[[4-[1-[2-(4-aminophenyl)-2,2-difluoroethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile (PubChem CID 161322135) has the molecular formula C20H17F2N7O and a molecular weight of 409.40 g/mol. Its IUPAC name is 3-[[4-[1-[2-(4-aminophenyl)-2,2-difluoroethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile.
| Compound Name | 3-[[4-[1-[2-(4-aminophenyl)-2,2-difluoroethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 161322135 |
| Molecular Formula | C20H17F2N7O |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[[4-[1-[2-(4-aminophenyl)-2,2-difluoroethyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-yl]amino]propanenitrile |
| SMILES | N#CCCNc1nonc1-c1nc2ccccc2n1CC(F)(F)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H17F2N7O/c21-20(22,13-6-8-14(24)9-7-13)12-29-16-5-2-1-4-15(16)26-19(29)17-18(28-30-27-17)25-11-3-10-23/h1-2,4-9H,3,11-12,24H2,(H,25,28) |
| InChIKey | VKGZBAXQDSZCDE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|