C26H26N2O5 — CID 123261261
propan-2-yl 2-[2-[[1-amino-2-(2-methoxyphenyl)ethylidene]amino]oxycarbonylphenyl]benzoate (PubChem CID 123261261) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is propan-2-yl 2-[2-[[1-amino-2-(2-methoxyphenyl)ethylidene]amino]oxycarbonylphenyl]benzoate.
| Compound Name | propan-2-yl 2-[2-[[1-amino-2-(2-methoxyphenyl)ethylidene]amino]oxycarbonylphenyl]benzoate |
|---|---|
| PubChem CID | 123261261 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | propan-2-yl 2-[2-[[1-amino-2-(2-methoxyphenyl)ethylidene]amino]oxycarbonylphenyl]benzoate |
| SMILES | COc1ccccc1CC(N)=NOC(=O)c1ccccc1-c1ccccc1C(=O)OC(C)C |
| InChI | InChI=1S/C26H26N2O5/c1-17(2)32-25(29)21-13-7-5-11-19(21)20-12-6-8-14-22(20)26(30)33-28-24(27)16-18-10-4-9-15-23(18)31-3/h4-15,17H,16H2,1-3H3,(H2,27,28) |
| InChIKey | JFVJDJDPXXIYAM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|