C18H18NO2S- — CID 123261654
2-[3-(sulfinatoamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (PubChem CID 123261654) has the molecular formula C18H18NO2S- and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[3-(sulfinatoamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene.
| Compound Name | 2-[3-(sulfinatoamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 123261654 |
| Molecular Formula | C18H18NO2S- |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[3-(sulfinatoamino)propylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| SMILES | O=S([O-])NCCC=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C18H19NO2S/c20-22(21)19-13-5-10-18-16-8-3-1-6-14(16)11-12-15-7-2-4-9-17(15)18/h1-4,6-10,19H,5,11-13H2,(H,20,21)/p-1 |
| InChIKey | MQGLMBWDGPONBD-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|