C23H35N — CID 143757919
(3E)-3-[6,7-bis(ethenyl)-8,9-dihydrobenzo[7]annulen-5-ylidene]-N-methylpropan-1-amine;ethane (PubChem CID 143757919) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is (3E)-3-[6,7-bis(ethenyl)-8,9-dihydrobenzo[7]annulen-5-ylidene]-N-methylpropan-1-amine;ethane.
| Compound Name | (3E)-3-[6,7-bis(ethenyl)-8,9-dihydrobenzo[7]annulen-5-ylidene]-N-methylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 143757919 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (3E)-3-[6,7-bis(ethenyl)-8,9-dihydrobenzo[7]annulen-5-ylidene]-N-methylpropan-1-amine;ethane |
| SMILES | C=CC1=C(C=C)/C(=C\CCNC)c2ccccc2CC1.CC.CC |
| InChI | InChI=1S/C19H23N.2C2H6/c1-4-15-12-13-16-9-6-7-10-18(16)19(17(15)5-2)11-8-14-20-3;2*1-2/h4-7,9-11,20H,1-2,8,12-14H2,3H3;2*1-2H3/b19-11+;; |
| InChIKey | TWEULZQRUSNIMK-KRYQRJNDSA-N |
| XLogP | 6.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|