C24H23FN2OS — CID 166592829
N-[(4-fluorophenyl)sulfonimidoyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine (PubChem CID 166592829) has the molecular formula C24H23FN2OS and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)sulfonimidoyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine.
| Compound Name | N-[(4-fluorophenyl)sulfonimidoyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine |
|---|---|
| PubChem CID | 166592829 |
| Molecular Formula | C24H23FN2OS |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(4-fluorophenyl)sulfonimidoyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine |
| SMILES | [H]N=S(=O)(NCCC=C1c2ccccc2CCc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN2OS/c25-20-13-15-21(16-14-20)29(26,28)27-17-5-10-24-22-8-3-1-6-18(22)11-12-19-7-2-4-9-23(19)24/h1-4,6-10,13-16H,5,11-12,17H2,(H2,26,27,28) |
| InChIKey | TXLSJPFZDXIDPJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|