C25H22N2O2S — CID 71263429
4-cyano-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide (PubChem CID 71263429) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-cyano-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71263429 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 4-cyano-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCC=C2c3ccccc3CCc3ccccc32)cc1 |
| InChI | InChI=1S/C25H22N2O2S/c26-18-19-11-15-22(16-12-19)30(28,29)27-17-5-10-25-23-8-3-1-6-20(23)13-14-21-7-2-4-9-24(21)25/h1-4,6-12,15-16,27H,5,13-14,17H2 |
| InChIKey | MVLMWGQZERWKDV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|