C15H28O7P2 — CID 123262042
phosphono [(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] hydrogen phosphate (PubChem CID 123262042) has the molecular formula C15H28O7P2 and a molecular weight of 382.33 g/mol. Its IUPAC name is phosphono [(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] hydrogen phosphate.
| Compound Name | phosphono [(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 123262042 |
| Molecular Formula | C15H28O7P2 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | phosphono [(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl] hydrogen phosphate |
| SMILES | C=C[C@](C)(CCC=C(C)CCC=C(C)C)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H28O7P2/c1-6-15(5,21-24(19,20)22-23(16,17)18)12-8-11-14(4)10-7-9-13(2)3/h6,9,11H,1,7-8,10,12H2,2-5H3,(H,19,20)(H2,16,17,18)/t15-/m1/s1 |
| InChIKey | SDXCRASCLFBFND-OAHLLOKOSA-N |
| XLogP | 4.63 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|