C16H30O7P2 — CID 162821133
phosphono [(4R,7E)-2,4,12-trimethyltrideca-2,7,11-trien-4-yl] hydrogen phosphate (PubChem CID 162821133) has the molecular formula C16H30O7P2 and a molecular weight of 396.36 g/mol. Its IUPAC name is phosphono [(4R,7E)-2,4,12-trimethyltrideca-2,7,11-trien-4-yl] hydrogen phosphate.
| Compound Name | phosphono [(4R,7E)-2,4,12-trimethyltrideca-2,7,11-trien-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 162821133 |
| Molecular Formula | C16H30O7P2 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | phosphono [(4R,7E)-2,4,12-trimethyltrideca-2,7,11-trien-4-yl] hydrogen phosphate |
| SMILES | CC(C)=CCC/C=C/CC[C@](C)(C=C(C)C)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C16H30O7P2/c1-14(2)11-9-7-6-8-10-12-16(5,13-15(3)4)22-25(20,21)23-24(17,18)19/h6,8,11,13H,7,9-10,12H2,1-5H3,(H,20,21)(H2,17,18,19)/b8-6+/t16-/m1/s1 |
| InChIKey | YPNPVUODYUBUPX-IQIBNGDESA-N |
| XLogP | 5.02 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|