C21H23NO5 — CID 123262644
4-(4-methoxyphenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one (PubChem CID 123262644) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one.
| Compound Name | 4-(4-methoxyphenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one |
|---|---|
| PubChem CID | 123262644 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one |
| SMILES | C=C1C(=O)N(Cc2cc(OC)c(OC)c(OC)c2)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-13-19(15-6-8-16(24-2)9-7-15)22(21(13)23)12-14-10-17(25-3)20(27-5)18(11-14)26-4/h6-11,19H,1,12H2,2-5H3 |
| InChIKey | YIHGIIPTPNNSBQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|