C22H16O6 — CID 123262895
3-[2-(3a,4-dihydro-1,3-benzodioxol-5-yl)-2-oxoethoxy]benzo[c]chromen-6-one (PubChem CID 123262895) has the molecular formula C22H16O6 and a molecular weight of 376.36 g/mol. Its IUPAC name is 3-[2-(3a,4-dihydro-1,3-benzodioxol-5-yl)-2-oxoethoxy]benzo[c]chromen-6-one.
| Compound Name | 3-[2-(3a,4-dihydro-1,3-benzodioxol-5-yl)-2-oxoethoxy]benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 123262895 |
| Molecular Formula | C22H16O6 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-[2-(3a,4-dihydro-1,3-benzodioxol-5-yl)-2-oxoethoxy]benzo[c]chromen-6-one |
| SMILES | O=C(COc1ccc2c(c1)oc(=O)c1ccccc12)C1=CC=C2OCOC2C1 |
| InChI | InChI=1S/C22H16O6/c23-18(13-5-8-19-21(9-13)27-12-26-19)11-25-14-6-7-16-15-3-1-2-4-17(15)22(24)28-20(16)10-14/h1-8,10,21H,9,11-12H2 |
| InChIKey | GAPNEDWCOFIZLJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|