C21H13ClO5 — CID 1332741
3-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]benzo[c]chromen-6-one (PubChem CID 1332741) has the molecular formula C21H13ClO5 and a molecular weight of 380.78 g/mol. Its IUPAC name is 3-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]benzo[c]chromen-6-one.
| Compound Name | 3-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 1332741 |
| Molecular Formula | C21H13ClO5 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 3-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]benzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(OCc3cc4c(cc3Cl)OCO4)ccc2c2ccccc12 |
| InChI | InChI=1S/C21H13ClO5/c22-17-9-20-19(25-11-26-20)7-12(17)10-24-13-5-6-15-14-3-1-2-4-16(14)21(23)27-18(15)8-13/h1-9H,10-11H2 |
| InChIKey | JROIQVHRWQVVJL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|