C10H12N2 — CID 123264807
6-(2,3-dihydropyridin-6-yl)-2,3-dihydropyridine (PubChem CID 123264807) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 6-(2,3-dihydropyridin-6-yl)-2,3-dihydropyridine.
| Compound Name | 6-(2,3-dihydropyridin-6-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123264807 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 6-(2,3-dihydropyridin-6-yl)-2,3-dihydropyridine |
| SMILES | C1=CC(C2=NCCC=C2)=NCC1 |
| InChI | InChI=1S/C10H12N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | VGHLAQKHRGJQHI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |