C7H13N3S — CID 123264875
N-(4,5-dihydro-1,3-thiazol-4-ylmethyl)-N,N'-dimethylmethanimidamide (PubChem CID 123264875) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-4-ylmethyl)-N,N'-dimethylmethanimidamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-4-ylmethyl)-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 123264875 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-4-ylmethyl)-N,N'-dimethylmethanimidamide |
| SMILES | C/N=C/N(C)CC1CSC=N1 |
| InChI | InChI=1S/C7H13N3S/c1-8-5-10(2)3-7-4-11-6-9-7/h5-7H,3-4H2,1-2H3/b8-5+ |
| InChIKey | UUPZGIDJBJMIEZ-VMPITWQZSA-N |
| XLogP | 0.72 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|