C9H17BN2O3 — CID 123265170
(3R,4S)-4-amino-3-(3-oxoboranylpropyl)piperidine-4-carboxylic acid (PubChem CID 123265170) has the molecular formula C9H17BN2O3 and a molecular weight of 212.06 g/mol. Its IUPAC name is (3R,4S)-4-amino-3-(3-oxoboranylpropyl)piperidine-4-carboxylic acid.
| Compound Name | (3R,4S)-4-amino-3-(3-oxoboranylpropyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 123265170 |
| Molecular Formula | C9H17BN2O3 |
| Molecular Weight | 212.06 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (3R,4S)-4-amino-3-(3-oxoboranylpropyl)piperidine-4-carboxylic acid |
| SMILES | N[C@@]1(C(=O)O)CCNC[C@H]1CCCB=O |
| InChI | InChI=1S/C9H17BN2O3/c11-9(8(13)14)3-5-12-6-7(9)2-1-4-10-15/h7,12H,1-6,11H2,(H,13,14)/t7-,9+/m1/s1 |
| InChIKey | IWTGKHDWZYEWIF-APPZFPTMSA-N |
| XLogP | -0.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.06 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|