C16H31BN3O5 — CID 159356901
CID 159356901 (PubChem CID 159356901) has the molecular formula C16H31BN3O5 and a molecular weight of 356.25 g/mol.
| Compound Name | CID 159356901 |
|---|---|
| PubChem CID | 159356901 |
| Molecular Formula | C16H31BN3O5 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | — |
| SMILES | C[C@H](N)C(=O)N1CCCC12CCC(N)(C(=O)O)C(CCC[B]O)C2.O |
| InChI | InChI=1S/C16H29BN3O4.H2O/c1-11(18)13(21)20-9-3-5-15(20)6-7-16(19,14(22)23)12(10-15)4-2-8-17-24;/h11-12,24H,2-10,18-19H2,1H3,(H,22,23);1H2/t11-,12?,15?,16?;/m0./s1 |
| InChIKey | GIMLQJLEXPJALN-KCWGDGKWSA-N |
| XLogP | -0.74 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|