C23H15BF2O2 — CID 123266411
4-anthracen-2-yl-2,2-difluoro-6-phenyl-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene (PubChem CID 123266411) has the molecular formula C23H15BF2O2 and a molecular weight of 372.18 g/mol. Its IUPAC name is 4-anthracen-2-yl-2,2-difluoro-6-phenyl-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene.
| Compound Name | 4-anthracen-2-yl-2,2-difluoro-6-phenyl-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene |
|---|---|
| PubChem CID | 123266411 |
| Molecular Formula | C23H15BF2O2 |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-anthracen-2-yl-2,2-difluoro-6-phenyl-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene |
| SMILES | F[B-]1(F)OC(c2ccccc2)=CC(c2ccc3cc4ccccc4cc3c2)=[O+]1 |
| InChI | InChI=1S/C23H15BF2O2/c25-24(26)27-22(16-6-2-1-3-7-16)15-23(28-24)20-11-10-19-12-17-8-4-5-9-18(17)13-21(19)14-20/h1-15H |
| InChIKey | FPECJNAKFLUZSL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|