C12H23N — CID 123270736
N,3,3,5,5-pentamethylhept-6-en-2-imine (PubChem CID 123270736) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N,3,3,5,5-pentamethylhept-6-en-2-imine.
| Compound Name | N,3,3,5,5-pentamethylhept-6-en-2-imine |
|---|---|
| PubChem CID | 123270736 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N,3,3,5,5-pentamethylhept-6-en-2-imine |
| SMILES | C=CC(C)(C)CC(C)(C)/C(C)=N/C |
| InChI | InChI=1S/C12H23N/c1-8-11(3,4)9-12(5,6)10(2)13-7/h8H,1,9H2,2-7H3/b13-10+ |
| InChIKey | PHVLFAOFFOTZHF-JLHYYAGUSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|