C9H17N — CID 123647931
N,4-dimethylhept-1-en-3-imine (PubChem CID 123647931) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is N,4-dimethylhept-1-en-3-imine.
| Compound Name | N,4-dimethylhept-1-en-3-imine |
|---|---|
| PubChem CID | 123647931 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N,4-dimethylhept-1-en-3-imine |
| SMILES | C=C/C(=N\C)C(C)CCC |
| InChI | InChI=1S/C9H17N/c1-5-7-8(3)9(6-2)10-4/h6,8H,2,5,7H2,1,3-4H3/b10-9+ |
| InChIKey | KFIBVOCCBAKIGG-MDZDMXLPSA-N |
| XLogP | 2.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|