C12H21N — CID 123444373
N,3,5-trimethylnona-5,8-dien-4-imine (PubChem CID 123444373) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N,3,5-trimethylnona-5,8-dien-4-imine.
| Compound Name | N,3,5-trimethylnona-5,8-dien-4-imine |
|---|---|
| PubChem CID | 123444373 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N,3,5-trimethylnona-5,8-dien-4-imine |
| SMILES | C=CCC=C(C)/C(=N/C)C(C)CC |
| InChI | InChI=1S/C12H21N/c1-6-8-9-11(4)12(13-5)10(3)7-2/h6,9-10H,1,7-8H2,2-5H3/b11-9?,13-12+ |
| InChIKey | CITDCJSLZAQTBH-IAMQCISTSA-N |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|