C14H25N — CID 123453605
N-hexyl-4-methylhepta-1,6-dien-3-imine (PubChem CID 123453605) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-hexyl-4-methylhepta-1,6-dien-3-imine.
| Compound Name | N-hexyl-4-methylhepta-1,6-dien-3-imine |
|---|---|
| PubChem CID | 123453605 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-hexyl-4-methylhepta-1,6-dien-3-imine |
| SMILES | C=CCC(C)/C(C=C)=N/CCCCCC |
| InChI | InChI=1S/C14H25N/c1-5-8-9-10-12-15-14(7-3)13(4)11-6-2/h6-7,13H,2-3,5,8-12H2,1,4H3/b15-14+ |
| InChIKey | NWYMGSBOCHFUHR-CCEZHUSRSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|