C10H17N — CID 123379998
5,6-dimethyl-5-prop-2-enyl-3,4-dihydro-2H-pyridine (PubChem CID 123379998) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 5,6-dimethyl-5-prop-2-enyl-3,4-dihydro-2H-pyridine.
| Compound Name | 5,6-dimethyl-5-prop-2-enyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 123379998 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5,6-dimethyl-5-prop-2-enyl-3,4-dihydro-2H-pyridine |
| SMILES | C=CCC1(C)CCCN=C1C |
| InChI | InChI=1S/C10H17N/c1-4-6-10(3)7-5-8-11-9(10)2/h4H,1,5-8H2,2-3H3 |
| InChIKey | XJZMSXAAKWVJCW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|