C17H32N3O3P — CID 123271364
N-[1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]-1-phosphanyl-3-propylpyrrolidine-2-carboxamide (PubChem CID 123271364) has the molecular formula C17H32N3O3P and a molecular weight of 357.44 g/mol. Its IUPAC name is N-[1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]-1-phosphanyl-3-propylpyrrolidine-2-carboxamide.
| Compound Name | N-[1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]-1-phosphanyl-3-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123271364 |
| Molecular Formula | C17H32N3O3P |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N-[1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]-1-phosphanyl-3-propylpyrrolidine-2-carboxamide |
| SMILES | CCCC1CCN(P)C1C(=O)NC(CCC)C(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C17H32N3O3P/c1-3-5-11-9-10-20(24)14(11)16(22)19-13(6-4-2)15(21)17(23)18-12-7-8-12/h11-15,21H,3-10,24H2,1-2H3,(H,18,23)(H,19,22) |
| InChIKey | HDOPIRXJEWFKRJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|