C28H48N4O6 — CID 140541692
tert-butyl N-[(2S)-2-[(3S,3aS,6aR)-3-[[(3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 140541692) has the molecular formula C28H48N4O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[(3S,3aS,6aR)-3-[[(3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[(3S,3aS,6aR)-3-[[(3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 140541692 |
| Molecular Formula | C28H48N4O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | tert-butyl N-[(2S)-2-[(3S,3aS,6aR)-3-[[(3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCC[C@H](NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1[C@@](C=O)(NC(=O)OC(C)(C)C)C(C)(C)C)C(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C28H48N4O6/c1-8-10-20(22(34)24(36)29-18-13-14-18)30-23(35)21-19-12-9-11-17(19)15-32(21)28(16-33,26(2,3)4)31-25(37)38-27(5,6)7/h16-22,34H,8-15H2,1-7H3,(H,29,36)(H,30,35)(H,31,37)/t17-,19-,20-,21-,22?,28+/m0/s1 |
| InChIKey | WOCBPSPVVNZFNU-YWPQDVMMSA-N |
| XLogP | 2.48 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|