C14H23NO4S — CID 123274688
ethyl 2-[2-hydroxypropan-2-yloxy-(4-methyl-1,3-thiazol-5-yl)methyl]butanoate (PubChem CID 123274688) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is ethyl 2-[2-hydroxypropan-2-yloxy-(4-methyl-1,3-thiazol-5-yl)methyl]butanoate.
| Compound Name | ethyl 2-[2-hydroxypropan-2-yloxy-(4-methyl-1,3-thiazol-5-yl)methyl]butanoate |
|---|---|
| PubChem CID | 123274688 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethyl 2-[2-hydroxypropan-2-yloxy-(4-methyl-1,3-thiazol-5-yl)methyl]butanoate |
| SMILES | CCOC(=O)C(CC)C(OC(C)(C)O)c1scnc1C |
| InChI | InChI=1S/C14H23NO4S/c1-6-10(13(16)18-7-2)11(19-14(4,5)17)12-9(3)15-8-20-12/h8,10-11,17H,6-7H2,1-5H3 |
| InChIKey | IUUGOBRULMOQFJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|