C21H22F7NO2 — CID 123275180
2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(5-fluorohepta-2,4,6-trien-2-yl)morpholine (PubChem CID 123275180) has the molecular formula C21H22F7NO2 and a molecular weight of 453.40 g/mol. Its IUPAC name is 2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(5-fluorohepta-2,4,6-trien-2-yl)morpholine.
| Compound Name | 2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(5-fluorohepta-2,4,6-trien-2-yl)morpholine |
|---|---|
| PubChem CID | 123275180 |
| Molecular Formula | C21H22F7NO2 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(5-fluorohepta-2,4,6-trien-2-yl)morpholine |
| SMILES | C=CC(F)=CC=C(C)C1NCCOC1OC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F7NO2/c1-4-17(22)6-5-12(2)18-19(30-8-7-29-18)31-13(3)14-9-15(20(23,24)25)11-16(10-14)21(26,27)28/h4-6,9-11,13,18-19,29H,1,7-8H2,2-3H3 |
| InChIKey | BZLJIJCVDMYJKE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|