C40H38N3O11P3+2 — CID 123276392
4-[[1,4,4,6-tetrakis(4-hydroxyphenoxy)-3-methyl-6-phenoxy-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol (PubChem CID 123276392) has the molecular formula C40H38N3O11P3+2 and a molecular weight of 829.68 g/mol. Its IUPAC name is 4-[[1,4,4,6-tetrakis(4-hydroxyphenoxy)-3-methyl-6-phenoxy-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol.
| Compound Name | 4-[[1,4,4,6-tetrakis(4-hydroxyphenoxy)-3-methyl-6-phenoxy-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol |
|---|---|
| PubChem CID | 123276392 |
| Molecular Formula | C40H38N3O11P3+2 |
| Molecular Weight | 829.68 g/mol |
| Exact Mass | 829.17 |
| IUPAC Name | 4-[[1,4,4,6-tetrakis(4-hydroxyphenoxy)-3-methyl-6-phenoxy-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol |
| SMILES | CC1N[P+]2(Oc3ccc(O)cc3)C(NP(Oc3ccccc3)(Oc3ccc(O)cc3)=N[P+]1(Oc1ccc(O)cc1)Oc1ccc(O)cc1)C2Oc1ccc(O)cc1 |
| InChI | InChI=1S/C40H36N3O11P3/c1-27-41-55(50-35-19-9-29(45)10-20-35)39(40(55)49-33-17-7-28(44)8-18-33)42-57(53-34-5-3-2-4-6-34,54-38-25-15-32(48)16-26-38)43-56(27,51-36-21-11-30(46)12-22-36)52-37-23-13-31(47)14-24-37/h2-27,39-42H,1H3,(H3-2,44,45,46,47,48)/p+2 |
| InChIKey | KXRSJDWVNWEION-UHFFFAOYSA-P |
| XLogP | 9.75 |
| TPSA | 192.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.68 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|