C4H5FN2S — CID 123276911
3-ethyl-5-fluoro-1,2,4-thiadiazole (PubChem CID 123276911) has the molecular formula C4H5FN2S and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-fluoro-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 123276911 |
| Molecular Formula | C4H5FN2S |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 3-ethyl-5-fluoro-1,2,4-thiadiazole |
| SMILES | CCc1nsc(F)n1 |
| InChI | InChI=1S/C4H5FN2S/c1-2-3-6-4(5)8-7-3/h2H2,1H3 |
| InChIKey | KQWYEHGWVAXOLD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |